Online Database of Chemicals from Around the World
|
CAS#: 81109-91-3 Product: N-Carboxymethyl-Phenylalanylleucine No suppilers available for the product. |
| Name | N-Carboxymethyl-Phenylalanylleucine |
|---|---|
| Synonyms | (2R)-2-[[(2R)-2-(Carboxymethylamino)-3-Phenyl-Propanoyl]Amino]-4-Methyl-Pentanoic Acid; (2R)-2-[[(2R)-2-(Carboxymethylamino)-1-Oxo-3-Phenylpropyl]Amino]-4-Methylpentanoic Acid; (2R)-2-[[(2R)-2-(Carboxymethylamino)-3-Phenyl-Propanoyl]Amino]-4-Methyl-Valeric Acid |
| Molecular Structure |  |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 |
| CAS Registry Number | 81109-91-3 |
| SMILES | [C@@H](C(=O)O)(NC([C@H](NCC(=O)O)CC1=CC=CC=C1)=O)CC(C)C |
| InChI | 1S/C17H24N2O5/c1-11(2)8-14(17(23)24)19-16(22)13(18-10-15(20)21)9-12-6-4-3-5-7-12/h3-7,11,13-14,18H,8-10H2,1-2H3,(H,19,22)(H,20,21)(H,23,24)/t13-,14-/m1/s1 |
| InChIKey | JETREHBNPJNSMA-ZIAGYGMSSA-N |
| Density | 1.219g/cm3 (Cal.) |
|---|---|
| Boiling point | 615.797°C at 760 mmHg (Cal.) |
| Flash point | 326.222°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Carboxymethyl-Phenylalanylleucine |