|
CAS#: 81199-24-8 Product: 3,5-Dibromophenylsuccinic Acid N-Methylimide No suppilers available for the product. |
| Name | 3,5-Dibromophenylsuccinic Acid N-Methylimide |
|---|---|
| Synonyms | 3-(3,5-Dibromophenyl)-1-Methyl-Pyrrolidine-2,5-Dione; 3-(3,5-Dibromophenyl)-1-Methyl-Pyrrolidine-2,5-Quinone; 2,5-Pyrrolidinedione, 3-(3,5-Dibromophenyl)-1-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C11H9Br2NO2 |
| Molecular Weight | 347.01 |
| CAS Registry Number | 81199-24-8 |
| SMILES | C1=C(C=C(C=C1C2C(N(C(C2)=O)C)=O)Br)Br |
| InChI | 1S/C11H9Br2NO2/c1-14-10(15)5-9(11(14)16)6-2-7(12)4-8(13)3-6/h2-4,9H,5H2,1H3 |
| InChIKey | TWHLAMOBWLHCHA-UHFFFAOYSA-N |
| Density | 1.833g/cm3 (Cal.) |
|---|---|
| Boiling point | 429.907°C at 760 mmHg (Cal.) |
| Flash point | 213.801°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,5-Dibromophenylsuccinic Acid N-Methylimide |