|
CAS#: 81254-01-5 Product: 2-(4-(Diethylamino)-1-Methylbutyl)-1H-Benz(de)Isoquinoline-1,3(2H)-Dione Monohydrobromide No suppilers available for the product. |
| Name | 2-(4-(Diethylamino)-1-Methylbutyl)-1H-Benz(de)Isoquinoline-1,3(2H)-Dione Monohydrobromide |
|---|---|
| Synonyms | 2-(4-(Diethylamino)-1-Methylbutyl)-1H-Benz(De)Isoquinoline-1,3(2H)-Dione Monohydrobromide |
| Molecular Structure | ![]() |
| Molecular Formula | C21H27BrN2O2 |
| Molecular Weight | 419.36 |
| CAS Registry Number | 81254-01-5 |
| SMILES | [H+].C3=C1C(=O)N(C(CCCN(CC)CC)C)C(=O)C2=CC=CC(=C12)C=C3.[Br-] |
| InChI | 1S/C21H26N2O2.BrH/c1-4-22(5-2)14-8-9-15(3)23-20(24)17-12-6-10-16-11-7-13-18(19(16)17)21(23)25;/h6-7,10-13,15H,4-5,8-9,14H2,1-3H3;1H |
| InChIKey | MDJBSMXXGDPZEE-UHFFFAOYSA-N |
| Boiling point | 484.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 201.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(4-(Diethylamino)-1-Methylbutyl)-1H-Benz(de)Isoquinoline-1,3(2H)-Dione Monohydrobromide |