|
CAS#: 81257-91-2 Product: 1,7,8,9-Tetrahydro-5-Chloropyrano(2,3-g)Indole-2-Carboxylic Acid No suppilers available for the product. |
| Name | 1,7,8,9-Tetrahydro-5-Chloropyrano(2,3-g)Indole-2-Carboxylic Acid |
|---|---|
| Synonyms | 1,7,8,9-Tetrahydro-5-Chloropyrano(2,3-G)Indole-2-Carboxylic Acid; Acide 5-Chloro-7,8,9-Trihydro-Pyranno(2,3-G)Indole-2-Carboxylique [French]; Pyrano(2,3-G)Indole-2-Carboxylic Acid, 1,7,8,9-Tetrahydro-5-Chloro- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H10ClNO3 |
| Molecular Weight | 251.67 |
| CAS Registry Number | 81257-91-2 |
| SMILES | C1=C([NH]C2=C1C=C(C3=C2CCCO3)Cl)C(=O)O |
| InChI | 1S/C12H10ClNO3/c13-8-4-6-5-9(12(15)16)14-10(6)7-2-1-3-17-11(7)8/h4-5,14H,1-3H2,(H,15,16) |
| InChIKey | JFETXCWYGDBXRH-UHFFFAOYSA-N |
| Density | 1.532g/cm3 (Cal.) |
|---|---|
| Boiling point | 537.479°C at 760 mmHg (Cal.) |
| Flash point | 278.858°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,7,8,9-Tetrahydro-5-Chloropyrano(2,3-g)Indole-2-Carboxylic Acid |