|
CAS#: 81265-18-1 Product: Ethyl 4-(Dichlorophenylmethyl)Benzoate No suppilers available for the product. |
| Name | Ethyl 4-(Dichlorophenylmethyl)Benzoate |
|---|---|
| Synonyms | 4-[(2,3-Dichlorophenyl)Methyl]Benzoic Acid Ethyl Ester; 4-(2,3-Dichlorobenzyl)Benzoic Acid Ethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C16H14Cl2O2 |
| Molecular Weight | 309.19 |
| CAS Registry Number | 81265-18-1 |
| EINECS | 279-715-7 |
| SMILES | C1=C(C(OCC)=O)C=CC(=C1)CC2=C(Cl)C(=CC=C2)Cl |
| InChI | 1S/C16H14Cl2O2/c1-2-20-16(19)12-8-6-11(7-9-12)10-13-4-3-5-14(17)15(13)18/h3-9H,2,10H2,1H3 |
| InChIKey | VIMWHSYVGMERMU-UHFFFAOYSA-N |
| Density | 1.251g/cm3 (Cal.) |
|---|---|
| Boiling point | 410.925°C at 760 mmHg (Cal.) |
| Flash point | 156.802°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 4-(Dichlorophenylmethyl)Benzoate |