|
CAS#: 81307-43-9 Product: Antibiotic F2 triacetate No suppilers available for the product. |
| Name | Antibiotic F2 triacetate |
|---|---|
| Synonyms | 9,17,21-O-Triacetyl tetronolide; Antibiotic F2 triacetate |
| Molecular Structure | ![]() |
| Molecular Formula | C38H46O11 |
| Molecular Weight | 678.77 |
| CAS Registry Number | 81307-43-9 |
| SMILES | O=C(O[C@@H]1C(=C/[C@@H]5[C@@H](OC(=O)C)\C=C(\C=O)CC45OC(\O)=C(\C(=O)[C@]2([C@H]3[C@H](\C=C/[C@H]2C(=C/C1)\C)[C@@H](OC(=O)C)[C@@H](C)C[C@@H]3C)C)C4=O)/C)C |
| InChI | 1S/C38H46O11/c1-18-9-12-29(46-22(5)40)19(2)14-28-30(47-23(6)41)15-25(17-39)16-38(28)35(44)31(36(45)49-38)34(43)37(8)27(18)11-10-26-32(37)20(3)13-21(4)33(26)48-24(7)42/h9-11,14-15,17,20-21,26-30,32-33,45H,12-13,16H2,1-8H3/b18-9-,19-14+/t20-,21-,26-,27-,28+,29-,30-,32+,33-,37+,38?/m0/s1 |
| InChIKey | UEJNHLMPSKPLFO-RONJDDDZSA-N |
| Density | 1.286g/cm3 (Cal.) |
|---|---|
| Boiling point | 756.034°C at 760 mmHg (Cal.) |
| Flash point | 227.844°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Antibiotic F2 triacetate |