|
CAS#: 81316-87-2 Product: 5-Nitrobenzo(ghi)Perylene No suppilers available for the product. |
| Name | 5-Nitrobenzo(ghi)Perylene |
|---|---|
| Synonyms | Benzo(Ghi)Perylene, 5-Nitro- |
| Molecular Structure | ![]() |
| Molecular Formula | C22H11NO2 |
| Molecular Weight | 321.33 |
| CAS Registry Number | 81316-87-2 |
| SMILES | C1=C4C2=C(C(=C1)[N+]([O-])=O)C=CC3=C2C5=C(C=C3)C=CC6=CC=CC4=C56 |
| InChI | 1S/C22H11NO2/c24-23(25)18-11-10-16-15-3-1-2-12-4-5-13-6-7-14-8-9-17(18)22(16)21(14)20(13)19(12)15/h1-11H |
| InChIKey | PEVCOODQXOIYQH-UHFFFAOYSA-N |
| Density | 1.514g/cm3 (Cal.) |
|---|---|
| Boiling point | 561.087°C at 760 mmHg (Cal.) |
| Flash point | 277.631°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Nitrobenzo(ghi)Perylene |