| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Perylene-3,4,9,10-Tetracarboxylic Acid |
|---|---|
| Synonyms | Nsc89768; 3,4,9,10-Perylenetetracarboxylic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C24H12O8 |
| Molecular Weight | 428.35 |
| CAS Registry Number | 81-32-3 |
| EINECS | 201-343-0 |
| SMILES | C5=C1C4=C(C2=CC=C(C3=C(C(O)=O)C=CC1=C23)C(O)=O)C=CC(=C4C(=C5)C(O)=O)C(O)=O |
| InChI | 1S/C24H12O8/c25-21(26)13-5-1-9-10-2-6-15(23(29)30)20-16(24(31)32)8-4-12(18(10)20)11-3-7-14(22(27)28)19(13)17(9)11/h1-8H,(H,25,26)(H,27,28)(H,29,30)(H,31,32) |
| InChIKey | FVDOBFPYBSDRKH-UHFFFAOYSA-N |
| Density | 1.74g/cm3 (Cal.) |
|---|---|
| Boiling point | 912.357°C at 760 mmHg (Cal.) |
| Flash point | 519.395°C (Cal.) |
| (1) | Da Chen, Longhua Tang and Jinghong Li. Graphene-based materials in electrochemistry, Chem. Soc. Rev., 2010, 39, 3157. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Perylene-3,4,9,10-Tetracarboxylic Acid |