|
CAS#: 81345-28-0 Product: Sapintoxin C No suppilers available for the product. |
| Name | Sapintoxin C |
|---|---|
| Synonyms | Sapintoxin C |
| Molecular Structure | ![]() |
| Molecular Formula | C30H37NO7 |
| Molecular Weight | 523.62 |
| CAS Registry Number | 81345-28-0 |
| SMILES | [C@@]25([C@H]([C@@H]1C=C([C@@H](O)[C@H]4[C@H]([C@]1([C@@H]([C@H]2OC(C3=CC=CC=C3NC)=O)C)O)C=C(C)C4=O)C)C5(C)C)OC(=O)C |
| InChI | 1S/C30H37NO7/c1-14-12-19-22(23(14)33)24(34)15(2)13-20-25-28(5,6)30(25,38-17(4)32)26(16(3)29(19,20)36)37-27(35)18-10-8-9-11-21(18)31-7/h8-13,16,19-20,22,24-26,31,34,36H,1-7H3/t16-,19-,20+,22+,24-,25-,26-,29+,30-/m1/s1 |
| InChIKey | KESIQXYRXFIECZ-UNEHIJSCSA-N |
| Density | 1.303g/cm3 (Cal.) |
|---|---|
| Boiling point | 657.828°C at 760 mmHg (Cal.) |
| Flash point | 351.642°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sapintoxin C |