|
CAS#: 81349-02-2 Product: Methyl(4-Nitrophenyl)-Phosphinic Acid No suppilers available for the product. |
| Name | Methyl(4-Nitrophenyl)-Phosphinic Acid |
|---|---|
| Synonyms | Phosphinic Acid, Methyl(4-Nitrophenyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C7H8NO4P |
| Molecular Weight | 201.12 |
| CAS Registry Number | 81349-02-2 |
| SMILES | C1=C([P](=O)(O)C)C=CC(=C1)[N+]([O-])=O |
| InChI | 1S/C7H8NO4P/c1-13(11,12)7-4-2-6(3-5-7)8(9)10/h2-5H,1H3,(H,11,12) |
| InChIKey | ZHMBLBLPJBIEKC-UHFFFAOYSA-N |
| Density | 1.416g/cm3 (Cal.) |
|---|---|
| Boiling point | 473.716°C at 760 mmHg (Cal.) |
| Flash point | 240.295°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl(4-Nitrophenyl)-Phosphinic Acid |