Online Database of Chemicals from Around the World
|
CAS#: 81593-15-9 Product: 1a,9b-Dihydro-1-Chloro-1H-Phenanthro(9,10-b)Azirine No suppilers available for the product. |
| Name | 1a,9b-Dihydro-1-Chloro-1H-Phenanthro(9,10-b)Azirine |
|---|---|
| Synonyms | 1H-Phenanthro(9,10-B)Azirine, 1A,9B-Dihydro-1-Chloro-; Brn 4680919; Ccris 2133 |
| Molecular Structure |  |
| Molecular Formula | C14H10ClN |
| Molecular Weight | 227.69 |
| CAS Registry Number | 81593-15-9 |
| SMILES | C1=CC=CC3=C1C2N(C2C4=C3C=CC=C4)Cl |
| InChI | 1S/C14H10ClN/c15-16-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14(13)16/h1-8,13-14H |
| InChIKey | RVZHGYYMTIKPPB-UHFFFAOYSA-N |
| Density | 1.387g/cm3 (Cal.) |
|---|---|
| Boiling point | 371.488°C at 760 mmHg (Cal.) |
| Flash point | 178.47°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1a,9b-Dihydro-1-Chloro-1H-Phenanthro(9,10-b)Azirine |