|
CAS#: 81608-62-0 Product: 4-Hydroxyequilin No suppilers available for the product. |
| Name | 4-Hydroxyequilin |
|---|---|
| Synonyms | 4-Hydroxyequilin; Estra-1,3,5(10),7-Tetraen-17-One, 3,4-Dihydroxy- |
| Molecular Structure | ![]() |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.35 |
| CAS Registry Number | 81608-62-0 |
| SMILES | [C@H]12[C@@](C(=O)CC1)(CC[C@H]3C2=CCC4=C3C=CC(=C4O)O)C |
| InChI | 1S/C18H20O3/c1-18-9-8-11-10-4-6-15(19)17(21)13(10)3-2-12(11)14(18)5-7-16(18)20/h2,4,6,11,14,19,21H,3,5,7-9H2,1H3/t11-,14+,18+/m1/s1 |
| InChIKey | LCKBCCZEGNYLDE-VZSAFFHGSA-N |
| Density | 1.318g/cm3 (Cal.) |
|---|---|
| Boiling point | 482.508°C at 760 mmHg (Cal.) |
| Flash point | 259.718°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Hydroxyequilin |