|
CAS#: 816-68-2 Product: Lead Malate No suppilers available for the product. |
| Name | Lead Malate |
|---|---|
| Synonyms | Plumbous 2-Hydroxybutanedioate; Plumbous 2-Hydroxysuccinate |
| Molecular Structure | ![]() |
| Molecular Formula | C4H4O5Pb |
| Molecular Weight | 339.27 |
| CAS Registry Number | 816-68-2 |
| EINECS | 212-436-0 |
| SMILES | C(C(O)C([O-])=O)C([O-])=O.[Pb++] |
| InChI | 1S/C4H6O5.Pb/c5-2(4(8)9)1-3(6)7;/h2,5H,1H2,(H,6,7)(H,8,9);/q;+2/p-2 |
| InChIKey | AQVKIYUWIAJIOT-UHFFFAOYSA-L |
| Boiling point | 306.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 153.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Lead Malate |