Online Database of Chemicals from Around the World
|
CAS#: 81640-32-6 Product: 1,5-Dimethylbicyclo[3.1.0]Hexane-2,3,4-Trione No suppilers available for the product. |
| Name | 1,5-Dimethylbicyclo[3.1.0]Hexane-2,3,4-Trione |
|---|---|
| Synonyms | Bicyclo[3.1.0]Hexane-2,3,4-Trione,1,5-Dimethyl-; Bicyclo(3.1.0)Hexane-2,3,4-Trione, 1,5-Dimethyl- |
| Molecular Structure | ![CAS#: 81640-32-6, 1,5-Dimethylbicyclo[3.1.0]Hexane-2,3,4-Trione](/moreStructures/81640-32-6.gif) |
| Molecular Formula | C8H8O3 |
| Molecular Weight | 152.15 |
| CAS Registry Number | 81640-32-6 |
| SMILES | CC12C(C(C(C1(C2)C)=O)=O)=O |
| InChI | 1S/C8H8O3/c1-7-3-8(7,2)6(11)4(9)5(7)10/h3H2,1-2H3 |
| InChIKey | ILUAVTSUMQJWCW-UHFFFAOYSA-N |
| Density | 1.429g/cm3 (Cal.) |
|---|---|
| Boiling point | 227.698°C at 760 mmHg (Cal.) |
| Flash point | 87.783°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,5-Dimethylbicyclo[3.1.0]Hexane-2,3,4-Trione |