|
CAS#: 81652-49-5 Product: 2-Isobutyl-3-Oxo-4-Chloro-2-Butylcarbonate No suppilers available for the product. |
| Name | 2-Isobutyl-3-Oxo-4-Chloro-2-Butylcarbonate |
|---|---|
| Synonyms | (3-Chloro-1-Methyl-2-Oxo-Propyl) Isobutyl Carbonate; Carbonic Acid (3-Chloro-1-Methyl-2-Oxopropyl) Isobutyl Ester; Carbonic Acid (3-Chloro-2-Keto-1-Methyl-Propyl) Isobutyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C9H15ClO4 |
| Molecular Weight | 222.67 |
| CAS Registry Number | 81652-49-5 |
| SMILES | C(OC(OC(C(=O)CCl)C)=O)C(C)C |
| InChI | 1S/C9H15ClO4/c1-6(2)5-13-9(12)14-7(3)8(11)4-10/h6-7H,4-5H2,1-3H3 |
| InChIKey | IDMZEFNUMDLDJO-UHFFFAOYSA-N |
| Density | 1.135g/cm3 (Cal.) |
|---|---|
| Boiling point | 266.507°C at 760 mmHg (Cal.) |
| Flash point | 100.181°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Isobutyl-3-Oxo-4-Chloro-2-Butylcarbonate |