|
CAS#: 81718-73-2 Product: 5-Methoxy-N,N,3-Trimethyl-2-Benzofurancarboxamide No suppilers available for the product. |
| Name | 5-Methoxy-N,N,3-Trimethyl-2-Benzofurancarboxamide |
|---|---|
| Synonyms | 5-Methoxy-N,N,3-Trimethyl-Benzofuran-2-Carboxamide; 5-Methoxy-N,N,3-Trimethyl-2-Benzofurancarboxamide; 2-Benzofurancarboxamide, 5-Methoxy-N,N,3-Trimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 |
| CAS Registry Number | 81718-73-2 |
| SMILES | C2=C1C(=C(OC1=CC=C2OC)C(=O)N(C)C)C |
| InChI | 1S/C13H15NO3/c1-8-10-7-9(16-4)5-6-11(10)17-12(8)13(15)14(2)3/h5-7H,1-4H3 |
| InChIKey | GYZLHRMOLXESCF-UHFFFAOYSA-N |
| Density | 1.155g/cm3 (Cal.) |
|---|---|
| Boiling point | 392.584°C at 760 mmHg (Cal.) |
| Flash point | 191.228°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Methoxy-N,N,3-Trimethyl-2-Benzofurancarboxamide |