|
CAS#: 81786-78-9 Product: 4,5,6,7,7-Pentamethyloct-4-En-3-One No suppilers available for the product. |
| Name | 4,5,6,7,7-Pentamethyloct-4-En-3-One |
|---|---|
| Synonyms | 4,5,6,7,7-Pentamethyloct-4-En-3-One |
| Molecular Structure | ![]() |
| Molecular Formula | C13H24O |
| Molecular Weight | 196.33 |
| CAS Registry Number | 81786-78-9 |
| EINECS | 279-826-0 |
| SMILES | C(C(=O)C(=C(C(C(C)(C)C)C)/C)\C)C |
| InChI | 1S/C13H24O/c1-8-12(14)10(3)9(2)11(4)13(5,6)7/h11H,8H2,1-7H3/b10-9+ |
| InChIKey | RJMPLNRTACPFQN-MDZDMXLPSA-N |
| Density | 0.839g/cm3 (Cal.) |
|---|---|
| Boiling point | 265.027°C at 760 mmHg (Cal.) |
| Flash point | 110.68°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,5,6,7,7-Pentamethyloct-4-En-3-One |