Online Database of Chemicals from Around the World
|
CAS#: 81818-54-4 Product: 2-Methyl-3-(3,7,11,15-Tetramethylhexadec-2-Enyl)-1,4-Naphthoquinone No suppilers available for the product. |
| Name | 2-Methyl-3-(3,7,11,15-Tetramethylhexadec-2-Enyl)-1,4-Naphthoquinone |
|---|---|
| Synonyms | 2-Methyl-3-(3,7,11,15-Tetramethylhexadec-2-Enyl)Naphthalene-1,4-Dione; 2-Methyl-3-[(E)-3,7,11,15-Tetramethylhexadec-2-Enyl]-1,4-Naphthoquinone; 2-Methyl-3-(3,7,11,15-Tetramethylhexadec-2-Enyl)-1,4-Naphthoquinone |
| Molecular Structure |  |
| Molecular Formula | C31H46O2 |
| Molecular Weight | 450.70 |
| CAS Registry Number | 81818-54-4 (27696-10-2) |
| EINECS | 279-833-9 |
| SMILES | C1=C2C(=CC=C1)C(C(=C(C2=O)C\C=C(\CCCC(CCCC(CCCC(C)C)C)C)C)C)=O |
| InChI | 1S/C31H46O2/c1-22(2)12-9-13-23(3)14-10-15-24(4)16-11-17-25(5)20-21-27-26(6)30(32)28-18-7-8-19-29(28)31(27)33/h7-8,18-20,22-24H,9-17,21H2,1-6H3/b25-20+ |
| InChIKey | MBWXNTAXLNYFJB-LKUDQCMESA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| 0.984 (Expl.) | |
| Melting point | -20°C (Expl.) |
| Boiling point | 140°C (Expl.) |
| 546.4±50.0°C at 760 mmHg (Cal.) | |
| Flash point | 110°C (Expl.) |
| 200.4±27.1°C (Cal.) | |
| Refractive index | 1.5252 (Expl.) |
| Safety Description | CAUTION: May irritate eyes, skin, and respiratory tract |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-3-(3,7,11,15-Tetramethylhexadec-2-Enyl)-1,4-Naphthoquinone |