|
CAS#: 82026-06-0 Product: 3-Ketoaphidicolin No suppilers available for the product. |
| Name | 3-Ketoaphidicolin |
|---|---|
| Synonyms | Nsc346198 |
| Molecular Structure | ![]() |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 |
| CAS Registry Number | 82026-06-0 |
| SMILES | C(C3(C4CC1C(C2(C(CC1)C(C(CC2)=O)(C)CO)C)(CC3)C4)O)O |
| InChI | 1S/C20H32O4/c1-17(11-21)15-4-3-13-9-14-10-19(13,7-8-20(14,24)12-22)18(15,2)6-5-16(17)23/h13-15,21-22,24H,3-12H2,1-2H3 |
| InChIKey | PCKFULMONJBMIR-UHFFFAOYSA-N |
| Density | 1.224g/cm3 (Cal.) |
|---|---|
| Boiling point | 506.895°C at 760 mmHg (Cal.) |
| Flash point | 274.451°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Ketoaphidicolin |