|
CAS#: 82137-90-4 Product: Dexamethasone-17-Carboxamide No suppilers available for the product. |
| Name | Dexamethasone-17-Carboxamide |
|---|---|
| Synonyms | (8S,9R,10S,11S,13S,14S,16R,17R)-9-Fluoro-11,17-Dihydroxy-3-Keto-10,13,16-Trimethyl-6,7,8,11,12,14,15,16-Octahydrocyclopenta[A]Phenanthrene-17-Carboxamide; 17-Carboxamide Dexamethasone; 17-Dxb |
| Molecular Structure | ![]() |
| Molecular Formula | C21H28FNO4 |
| Molecular Weight | 377.45 |
| CAS Registry Number | 82137-90-4 |
| SMILES | [C@H]34[C@H]2[C@@](F)([C@@]1(C(=CC(=O)C=C1)CC2)C)[C@@H](O)C[C@@]3([C@](O)([C@@H](C4)C)C(=O)N)C |
| InChI | 1S/C21H28FNO4/c1-11-8-15-14-5-4-12-9-13(24)6-7-18(12,2)20(14,22)16(25)10-19(15,3)21(11,27)17(23)26/h6-7,9,11,14-16,25,27H,4-5,8,10H2,1-3H3,(H2,23,26)/t11-,14+,15+,16+,18+,19+,20+,21+/m1/s1 |
| InChIKey | PILCISDJZUQFIS-AFKBWYBQSA-N |
| Density | 1.318g/cm3 (Cal.) |
|---|---|
| Boiling point | 593.299°C at 760 mmHg (Cal.) |
| Flash point | 312.616°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dexamethasone-17-Carboxamide |