|
CAS#: 82183-64-0 Product: 10beta-Hydroxy-4-estrene-3,17-dione formate No suppilers available for the product. |
| Name | 10beta-Hydroxy-4-estrene-3,17-dione formate |
|---|---|
| Synonyms | Formic Acid [(8S,9S,13S,14S)-13-Methyl-3,17-Dioxo-2,6,7,8,9,11,12,14,15,16-Decahydro-1H-Cyclopenta[A]Phenanthren-10-Yl] Ester; Formic Acid [(8S,9S,13S,14S)-3,17-Diketo-13-Methyl-2,6,7,8,9,11,12,14,15,16-Decahydro-1H-Cyclopenta[A]Phenanthren-10-Yl] Ester; [(8S,9S,13S,14S)-13-Methyl-3,17-Dioxo-2,6,7,8,9,11,12,14,15,16-Decahydro-1H-Cyclopenta[A]Phenanthren-10-Yl] Methanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 |
| CAS Registry Number | 82183-64-0 |
| SMILES | [C@@H]23CCC1=CC(CCC1([C@H]2CC[C@]4([C@H]3CCC4=O)C)OC=O)=O |
| InChI | 1S/C19H24O4/c1-18-8-7-16-14(15(18)4-5-17(18)22)3-2-12-10-13(21)6-9-19(12,16)23-11-20/h10-11,14-16H,2-9H2,1H3/t14-,15-,16-,18-,19?/m0/s1 |
| InChIKey | HPRLLPRHJQYFQS-WYDHKZDJSA-N |
| Density | 1.221g/cm3 (Cal.) |
|---|---|
| Boiling point | 473.81°C at 760 mmHg (Cal.) |
| Flash point | 209.031°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 10beta-Hydroxy-4-estrene-3,17-dione formate |