|
CAS#: 82280-61-3 Product: 3,7,12,25-Tetrahydroxycholestan-24-One No suppilers available for the product. |
| Name | 3,7,12,25-Tetrahydroxycholestan-24-One |
|---|---|
| Synonyms | 3,7,12,25-Thcho; 3,7,12,25-Tetrahydroxycholestan-24-One; 3Alpha,7Alpha,12Alpha,25-Tetrahydroxy-5Beta-Cholestan-24-One |
| Molecular Structure | ![]() |
| Molecular Formula | C27H46O5 |
| Molecular Weight | 450.66 |
| CAS Registry Number | 82280-61-3 |
| SMILES | [C@H]1(CC[C@]3([C@@H](C1)C[C@H]([C@H]4[C@@H]2CC[C@H]([C@@H](CCC(C(C)(C)O)=O)C)[C@@]2(C)[C@H](C[C@H]34)O)O)C)O |
| InChI | 1S/C27H46O5/c1-15(6-9-22(30)25(2,3)32)18-7-8-19-24-20(14-23(31)27(18,19)5)26(4)11-10-17(28)12-16(26)13-21(24)29/h15-21,23-24,28-29,31-32H,6-14H2,1-5H3/t15-,16+,17-,18-,19+,20+,21-,23+,24+,26+,27-/m1/s1 |
| InChIKey | CFVCOEMVLNMDAX-LIIZXMBISA-N |
| Density | 1.143g/cm3 (Cal.) |
|---|---|
| Boiling point | 593.795°C at 760 mmHg (Cal.) |
| Flash point | 326.948°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,7,12,25-Tetrahydroxycholestan-24-One |