|
CAS#: 82409-34-5 Product: 2,3,4,5-Tetrahydro-3-Phenyl-1H-1,5,3-Benzodiazaphosphepine 3-Sulfide No suppilers available for the product. |
| Name | 2,3,4,5-Tetrahydro-3-Phenyl-1H-1,5,3-Benzodiazaphosphepine 3-Sulfide |
|---|---|
| Synonyms | 4-Phenyl-4-Thioxo-2,6-Diaza-4$L^{5}-Phosphabicyclo[5.4.0]Undeca-1(11),7,9-Triene; 2,3,4,5-Tetrahydro-3-Phenyl-1H-1,5,3-Benzodiazaphosphepine 3-Sulfide; Brn 5036631 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H15N2PS |
| Molecular Weight | 274.32 |
| CAS Registry Number | 82409-34-5 |
| SMILES | C3=C([P]2(=S)CNC1=CC=CC=C1NC2)C=CC=C3 |
| InChI | 1S/C14H15N2PS/c18-17(12-6-2-1-3-7-12)10-15-13-8-4-5-9-14(13)16-11-17/h1-9,15-16H,10-11H2 |
| InChIKey | RRHDWIFMDKEMPL-UHFFFAOYSA-N |
| Density | 1.285g/cm3 (Cal.) |
|---|---|
| Boiling point | 471.888°C at 760 mmHg (Cal.) |
| Flash point | 239.189°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3,4,5-Tetrahydro-3-Phenyl-1H-1,5,3-Benzodiazaphosphepine 3-Sulfide |