|
CAS#: 82458-41-1 Product: 2,3-Dihydro-1,3,3-Trimethyl-2-(1-Methylethylidene)-1H-Indole No suppilers available for the product. |
| Name | 2,3-Dihydro-1,3,3-Trimethyl-2-(1-Methylethylidene)-1H-Indole |
|---|---|
| Synonyms | 2-Isopropylidene-1,3,3-Trimethyl-Indoline; 2-Isopropylidene-1,3,3-Trimethylindoline; 1,3,3-Trimethyl-2-Propan-2-Ylidene-Indole |
| Molecular Structure | ![]() |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 |
| CAS Registry Number | 82458-41-1 |
| SMILES | C2=C1C(C(N(C1=CC=C2)C)=C(C)C)(C)C |
| InChI | 1S/C14H19N/c1-10(2)13-14(3,4)11-8-6-7-9-12(11)15(13)5/h6-9H,1-5H3 |
| InChIKey | YXIRXGTXIVOOCN-UHFFFAOYSA-N |
| Density | 0.959g/cm3 (Cal.) |
|---|---|
| Boiling point | 274.198°C at 760 mmHg (Cal.) |
| Flash point | 109.37°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Dihydro-1,3,3-Trimethyl-2-(1-Methylethylidene)-1H-Indole |