|
CAS#: 82461-15-2 Product: beta-Allyl-beta-Methylphenethyl Alcohol No suppilers available for the product. |
| Name | beta-Allyl-beta-Methylphenethyl Alcohol |
|---|---|
| Synonyms | 2-Methyl-2-Phenyl-Pent-4-En-1-Ol; Beta-Allyl-Beta-Methylphenethyl Alcohol |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 |
| CAS Registry Number | 82461-15-2 |
| EINECS | 279-968-3 |
| SMILES | C1=C(C(CO)(CC=C)C)C=CC=C1 |
| InChI | 1S/C12H16O/c1-3-9-12(2,10-13)11-7-5-4-6-8-11/h3-8,13H,1,9-10H2,2H3 |
| InChIKey | STSNKLAYQBTGNG-UHFFFAOYSA-N |
| Density | 0.97g/cm3 (Cal.) |
|---|---|
| Boiling point | 276.854°C at 760 mmHg (Cal.) |
| Flash point | 114.355°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for beta-Allyl-beta-Methylphenethyl Alcohol |