|
CAS#: 82486-67-7 Product: Glycyl-Glycyl-Tyrosine N-Methylamide No suppilers available for the product. |
| Name | Glycyl-Glycyl-Tyrosine N-Methylamide |
|---|---|
| Synonyms | (2S)-N-[2-[(2-Aminoacetyl)Amino]Acetyl]-3-(4-Hydroxyphenyl)-2-Methylamino-Propanamide; (2S)-N-[2-[(2-Amino-1-Oxoethyl)Amino]-1-Oxoethyl]-3-(4-Hydroxyphenyl)-2-Methylaminopropanamide; (2S)-N-[2-(Glycylamino)Acetyl]-3-(4-Hydroxyphenyl)-2-Methylamino-Propionamide |
| Molecular Structure | ![]() |
| Molecular Formula | C14H20N4O4 |
| Molecular Weight | 308.34 |
| CAS Registry Number | 82486-67-7 |
| SMILES | [C@H](C(=O)NC(CNC(CN)=O)=O)(NC)CC1=CC=C(O)C=C1 |
| InChI | 1S/C14H20N4O4/c1-16-11(6-9-2-4-10(19)5-3-9)14(22)18-13(21)8-17-12(20)7-15/h2-5,11,16,19H,6-8,15H2,1H3,(H,17,20)(H,18,21,22)/t11-/m0/s1 |
| InChIKey | KONGJQZWULAVJZ-NSHDSACASA-N |
| Density | 1.276g/cm3 (Cal.) |
|---|---|
| Boiling point | 634.458°C at 760 mmHg (Cal.) |
| Flash point | 337.508°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Glycyl-Glycyl-Tyrosine N-Methylamide |