|
CAS#: 82563-75-5 Product: 2-Methyl-3,4-Dihydro-1H-Isoquinoline-4,6,7-Triol No suppilers available for the product. |
| Name | 2-Methyl-3,4-Dihydro-1H-Isoquinoline-4,6,7-Triol |
|---|---|
| Synonyms | 2-Methyl-1,2,3,4-Tetrahydro-4,6,7-Isoquinolinetriol; Aids-151805; Aids151805 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 |
| CAS Registry Number | 82563-75-5 |
| SMILES | C1=C(O)C(=CC2=C1C(O)CN(C2)C)O |
| InChI | 1S/C10H13NO3/c1-11-4-6-2-8(12)9(13)3-7(6)10(14)5-11/h2-3,10,12-14H,4-5H2,1H3 |
| InChIKey | PIJDIPDQQMXWEM-UHFFFAOYSA-N |
| Density | 1.383g/cm3 (Cal.) |
|---|---|
| Boiling point | 404.302°C at 760 mmHg (Cal.) |
| Flash point | 244.652°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-3,4-Dihydro-1H-Isoquinoline-4,6,7-Triol |