|
CAS#: 82682-94-8 Product: Bis(2-Bromoallyl) Methylphosphate No suppilers available for the product. |
| Name | Bis(2-Bromoallyl) Methylphosphate |
|---|---|
| Synonyms | Phosphoric Acid Bis(2-Bromoprop-2-Enyl) Methyl Ester; Bis(2-Bromoallyl) Methylphosphate; Phosphoric Acid, Bis(2-Bromoallyl) Methyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C7H11Br2O4P |
| Molecular Weight | 349.94 |
| CAS Registry Number | 82682-94-8 |
| SMILES | C(O[P](=O)(OC)OCC(=C)Br)C(=C)Br |
| InChI | 1S/C7H11Br2O4P/c1-6(8)4-12-14(10,11-3)13-5-7(2)9/h1-2,4-5H2,3H3 |
| InChIKey | UQAMBLKUUZHHEQ-UHFFFAOYSA-N |
| Density | 1.72g/cm3 (Cal.) |
|---|---|
| Boiling point | 317.758°C at 760 mmHg (Cal.) |
| Flash point | 145.975°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(2-Bromoallyl) Methylphosphate |