|
CAS#: 82697-74-3 Product: 2-(2-Methoxyphenyl)-5-Methyl-4-Thiazolidinone No suppilers available for the product. |
| Name | 2-(2-Methoxyphenyl)-5-Methyl-4-Thiazolidinone |
|---|---|
| Synonyms | 2-(2-Methoxyphenyl)-5-Methyl-Thiazolidin-4-One; 2-(2-Methoxyphenyl)-5-Methyl-4-Thiazolidinone; 2-(2-Methoxyphenyl)-5-Methylthiazolidine-4-One |
| Molecular Structure | ![]() |
| Molecular Formula | C11H13NO2S |
| Molecular Weight | 223.29 |
| CAS Registry Number | 82697-74-3 |
| SMILES | C1=C(C(=CC=C1)C2SC(C(N2)=O)C)OC |
| InChI | 1S/C11H13NO2S/c1-7-10(13)12-11(15-7)8-5-3-4-6-9(8)14-2/h3-7,11H,1-2H3,(H,12,13) |
| InChIKey | ONARVZUZXPSUJA-UHFFFAOYSA-N |
| Density | 1.182g/cm3 (Cal.) |
|---|---|
| Boiling point | 434.737°C at 760 mmHg (Cal.) |
| Flash point | 216.721°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(2-Methoxyphenyl)-5-Methyl-4-Thiazolidinone |