|
CAS#: 82721-25-3 Product: 6,10-Dimethylbenzo(a)Pyrene No suppilers available for the product. |
| Name | 6,10-Dimethylbenzo(a)Pyrene |
|---|---|
| Synonyms | 6,10-Dimethylbenzo(A)Pyrene; Benzo(A)Pyrene, 6,10-Dimethyl-; 6,10-Dimethyl-Bp |
| Molecular Structure | ![]() |
| Molecular Formula | C22H16 |
| Molecular Weight | 280.37 |
| CAS Registry Number | 82721-25-3 |
| SMILES | C2=CC4=CC=CC5=CC=C3C1=C(C=CC=C1C(=C2C3=C45)C)C |
| InChI | 1S/C22H16/c1-13-5-3-8-17-14(2)18-11-9-15-6-4-7-16-10-12-19(20(13)17)22(18)21(15)16/h3-12H,1-2H3 |
| InChIKey | UQJYUXXPNGHKLM-UHFFFAOYSA-N |
| Density | 1.226g/cm3 (Cal.) |
|---|---|
| Boiling point | 492.574°C at 760 mmHg (Cal.) |
| Flash point | 245.675°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,10-Dimethylbenzo(a)Pyrene |