|
CAS#: 827299-41-2 Product: 4-Mesityl-3,3-dimethyl-2-butanol No suppilers available for the product. |
| Name | 4-Mesityl-3,3-dimethyl-2-butanol |
|---|---|
| Synonyms | 4-Mesityl-3,3-dimethyl-2-butanol; 4-Mesityl-3,3-dimethyl-2-butanol; 4-Mésityl-3,3-diméthyl-2-butanol |
| Molecular Structure | ![]() |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.35 |
| CAS Registry Number | 827299-41-2 |
| SMILES | Cc1cc(c(c(c1)C)CC(C)(C)C(C)O)C |
| InChI | 1S/C15H24O/c1-10-7-11(2)14(12(3)8-10)9-15(5,6)13(4)16/h7-8,13,16H,9H2,1-6H3 |
| InChIKey | JMDIFEYDFZWGCP-UHFFFAOYSA-N |
| Density | 0.9±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 327.8±11.0°C at 760 mmHg (Cal.) |
| Flash point | 123.4±15.1°C (Cal.) |
| Refractive index | 1.51 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Mesityl-3,3-dimethyl-2-butanol |