|
CAS#: 827607-35-2 Product: 5,5-Dimethyl-4,8-dioxatricyclo[4.2.1.03,7]non-2-yl acrylate No suppilers available for the product. |
| Name | 5,5-Dimethyl-4,8-dioxatricyclo[4.2.1.03,7]non-2-yl acrylate |
|---|---|
| Synonyms | 2-Propeno |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.25 |
| CAS Registry Number | 827607-35-2 |
| SMILES | CC1(C2CC3C(C(C2O3)O1)OC(=O)C=C)C |
| InChI | 1S/C12H16O4/c1-4-8(13)15-10-7-5-6-9(14-7)11(10)16-12(6,2)3/h4,6-7,9-11H,1,5H2,2-3H3 |
| InChIKey | MWUHXEROIATSHY-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 294.7±30.0°C at 760 mmHg (Cal.) |
| Flash point | 126.5±24.6°C (Cal.) |
| Refractive index | 1.522 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,5-Dimethyl-4,8-dioxatricyclo[4.2.1.03,7]non-2-yl acrylate |