|
CAS#: 82784-82-5 Product: 3,4-Dihydroxyphthalic Acid No suppilers available for the product. |
| Name | 3,4-Dihydroxyphthalic Acid |
|---|---|
| Synonyms | 3,4-Dihydroxyphthalate; C03223; Chebi:17416 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H6O6 |
| Molecular Weight | 198.13 |
| CAS Registry Number | 82784-82-5 |
| SMILES | C1=C(C(=C(O)C(=C1)O)C(O)=O)C(O)=O |
| InChI | 1S/C8H6O6/c9-4-2-1-3(7(11)12)5(6(4)10)8(13)14/h1-2,9-10H,(H,11,12)(H,13,14) |
| InChIKey | QXGJCWSBOZXWOV-UHFFFAOYSA-N |
| Density | 1.779g/cm3 (Cal.) |
|---|---|
| Boiling point | 487.233°C at 760 mmHg (Cal.) |
| Flash point | 262.573°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4-Dihydroxyphthalic Acid |