Online Database of Chemicals from Around the World
|
CAS#: 82846-25-1 Product: 3,4-Bis(3',3'-Dimethoxyphenyl)-3-Hexene No suppilers available for the product. |
| Name | 3,4-Bis(3',3'-Dimethoxyphenyl)-3-Hexene |
|---|---|
| Synonyms | 4-[(E)-2-(3,4-Dimethoxyphenyl)-1-Ethyl-But-1-Enyl]-1,2-Dimethoxy-Benzene; 4-[(E)-2-(3,4-Dimethoxyphenyl)-1-Ethylbut-1-Enyl]-1,2-Dimethoxybenzene; 4-[(E)-4-(3,4-Dimethoxyphenyl)Hex-3-En-3-Yl]-1,2-Dimethoxy-Benzene |
| Molecular Structure |  |
| Molecular Formula | C22H28O4 |
| Molecular Weight | 356.46 |
| CAS Registry Number | 82846-25-1 |
| SMILES | C1=C(OC)C(=CC=C1C(=C(C2=CC=C(OC)C(=C2)OC)\CC)/CC)OC |
| InChI | 1S/C22H28O4/c1-7-17(15-9-11-19(23-3)21(13-15)25-5)18(8-2)16-10-12-20(24-4)22(14-16)26-6/h9-14H,7-8H2,1-6H3/b18-17+ |
| InChIKey | HHGWEXLKPYHSBU-ISLYRVAYSA-N |
| Density | 1.044g/cm3 (Cal.) |
|---|---|
| Boiling point | 467.828°C at 760 mmHg (Cal.) |
| Flash point | 116.601°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4-Bis(3',3'-Dimethoxyphenyl)-3-Hexene |