|
CAS#: 82859-54-9 Product: 7,8-Dimethyl-Benzo(a)Pyrene No suppilers available for the product. |
| Name | 7,8-Dimethyl-Benzo(a)Pyrene |
|---|---|
| Synonyms | 7,8-Dimethylbenzo(A)Pyrene; Benzo(A)Pyrene, 7,8-Dimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C22H16 |
| Molecular Weight | 280.37 |
| CAS Registry Number | 82859-54-9 |
| SMILES | C1=C3C=CC4=CC=CC5=CC=C(C2=CC=C(C(=C12)C)C)C3=C45 |
| InChI | 1S/C22H16/c1-13-6-10-18-19-11-9-16-5-3-4-15-7-8-17(22(19)21(15)16)12-20(18)14(13)2/h3-12H,1-2H3 |
| InChIKey | KYFAMXWYAHVIOE-UHFFFAOYSA-N |
| Density | 1.226g/cm3 (Cal.) |
|---|---|
| Boiling point | 495.53°C at 760 mmHg (Cal.) |
| Flash point | 247.441°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7,8-Dimethyl-Benzo(a)Pyrene |