|
CAS#: 82875-67-0 Product: 1,2,3,5,6,7-Hexahydro-alpha-methyl-S-indacene-4-ethanamine hydrochloride No suppilers available for the product. |
| Name | 1,2,3,5,6,7-Hexahydro-alpha-methyl-S-indacene-4-ethanamine hydrochloride |
|---|---|
| Synonyms | [2-(1,2,3,5,6,7-Hexahydro-S-Indacen-4-Yl)-1-Methyl-Ethyl]Amine Hydrochloride; 1,2,3,5,6,7-Hexahydro-Alpha-Methyl-S-Indacene-4-Ethanamine Hydrochloride; 1-(S-Hydrindacen-4-Yl)-2-Propylamine Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C15H22ClN |
| Molecular Weight | 251.80 |
| CAS Registry Number | 82875-67-0 |
| SMILES | [H+].C1=C3C(=C(C2=C1CCC2)CC(N)C)CCC3.[Cl-] |
| InChI | 1S/C15H21N.ClH/c1-10(16)8-15-13-6-2-4-11(13)9-12-5-3-7-14(12)15;/h9-10H,2-8,16H2,1H3;1H |
| InChIKey | KROKBFPMLFVZEQ-UHFFFAOYSA-N |
| Boiling point | 334.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 138.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,5,6,7-Hexahydro-alpha-methyl-S-indacene-4-ethanamine hydrochloride |