|
CAS#: 82911-59-9 Product: 1,6,8-Trichlorodibenzofuran No suppilers available for the product. |
| Name | 1,6,8-Trichlorodibenzofuran |
|---|---|
| Synonyms | 2,4,9-Trichlorodibenzofuran; Dibenzofuran, 2,4,9-Trichloro |
| Molecular Structure | ![]() |
| Molecular Formula | C12H5Cl3O |
| Molecular Weight | 271.53 |
| CAS Registry Number | 82911-59-9 |
| SMILES | C1=CC=C3C(=C1Cl)C2=C(C(=CC(=C2)Cl)Cl)O3 |
| InChI | 1S/C12H5Cl3O/c13-6-4-7-11-8(14)2-1-3-10(11)16-12(7)9(15)5-6/h1-5H |
| InChIKey | ZOBVYDQWZXUJNO-UHFFFAOYSA-N |
| Density | 1.54g/cm3 (Cal.) |
|---|---|
| Boiling point | 387.114°C at 760 mmHg (Cal.) |
| Flash point | 187.92°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,6,8-Trichlorodibenzofuran |