|
CAS#: 82918-98-7 Product: 1,3-Dimethyl-3-Methoxy-4-Phenylazetidinone No suppilers available for the product. |
| Name | 1,3-Dimethyl-3-Methoxy-4-Phenylazetidinone |
|---|---|
| Synonyms | 3-Methoxy-1,3-Dimethyl-4-Phenyl-Azetidin-2-One; 3-Methoxy-1,3-Dimethyl-4-Phenyl-2-Azetidinone; Nsc 369777 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 |
| CAS Registry Number | 82918-98-7 |
| SMILES | C1=CC=CC=C1C2C(C(=O)N2C)(OC)C |
| InChI | 1S/C12H15NO2/c1-12(15-3)10(13(2)11(12)14)9-7-5-4-6-8-9/h4-8,10H,1-3H3 |
| InChIKey | WOOVUBIJEITYNW-UHFFFAOYSA-N |
| Density | 1.135g/cm3 (Cal.) |
|---|---|
| Boiling point | 332.028°C at 760 mmHg (Cal.) |
| Flash point | 154.605°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Dimethyl-3-Methoxy-4-Phenylazetidinone |