|
CAS#: 82935-28-2 Product: 2,6-Diethoxy-N-[(1-Ethylpyrrolidin-1-Ium-2-Yl)Methyl]Benzamide Chloride No suppilers available for the product. |
| Name | 2,6-Diethoxy-N-[(1-Ethylpyrrolidin-1-Ium-2-Yl)Methyl]Benzamide Chloride |
|---|---|
| Synonyms | 2,6-Diethoxy-N-[(1-Ethyl-2-Pyrrolidin-1-Iumyl)Methyl]Benzamide Chloride; 2,6-Diethoxy-N-(1-Ethyl-2-Pyrrolidinylmethyl)Benzamide Hydrochloride; 2-((2,6-Diethoxybenzamido)Methyl)-1-Ethylpyrrolidine Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C18H29ClN2O3 |
| Molecular Weight | 356.89 |
| CAS Registry Number | 82935-28-2 |
| SMILES | C1=CC=C(C(=C1OCC)C(NCC2[NH+](CCC2)CC)=O)OCC.[Cl-] |
| InChI | 1S/C18H28N2O3.ClH/c1-4-20-12-8-9-14(20)13-19-18(21)17-15(22-5-2)10-7-11-16(17)23-6-3;/h7,10-11,14H,4-6,8-9,12-13H2,1-3H3,(H,19,21);1H |
| InChIKey | FOIDWHDIXHGIBP-UHFFFAOYSA-N |
| Boiling point | 453.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 228.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,6-Diethoxy-N-[(1-Ethylpyrrolidin-1-Ium-2-Yl)Methyl]Benzamide Chloride |