|
CAS#: 82951-55-1 Product: (2S)-6-Amino-2-[[(2R)-2-Amino-3-(Carboxymethylsulfanyl)Propanoyl]Amino]Hexanoic Acid No suppilers available for the product. |
| Name | (2S)-6-Amino-2-[[(2R)-2-Amino-3-(Carboxymethylsulfanyl)Propanoyl]Amino]Hexanoic Acid |
|---|---|
| Synonyms | (2S)-6-Amino-2-[[(2R)-2-Amino-3-(Carboxymethylthio)-1-Oxopropyl]Amino]Hexanoic Acid; (2S)-6-Amino-2-[[(2R)-2-Amino-3-(Carboxymethylthio)Propanoyl]Amino]Hexanoic Acid; Carbocysteine-Lysine |
| Molecular Structure | ![]() |
| Molecular Formula | C11H21N3O5S |
| Molecular Weight | 307.36 |
| CAS Registry Number | 82951-55-1 |
| SMILES | [C@H](C(=O)O)(NC([C@@H](N)CSCC(=O)O)=O)CCCCN |
| InChI | 1S/C11H21N3O5S/c12-4-2-1-3-8(11(18)19)14-10(17)7(13)5-20-6-9(15)16/h7-8H,1-6,12-13H2,(H,14,17)(H,15,16)(H,18,19)/t7-,8-/m0/s1 |
| InChIKey | ZXFWVUHYOBPQHY-YUMQZZPRSA-N |
| Density | 1.352g/cm3 (Cal.) |
|---|---|
| Boiling point | 636.51°C at 760 mmHg (Cal.) |
| Flash point | 338.749°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2S)-6-Amino-2-[[(2R)-2-Amino-3-(Carboxymethylsulfanyl)Propanoyl]Amino]Hexanoic Acid |