|
CAS#: 82965-44-4 Product: 2-Chloro-4-(dimethylaminomethyl)-6-methylphenol No suppilers available for the product. |
| Name | 2-Chloro-4-(dimethylaminomethyl)-6-methylphenol |
|---|---|
| Synonyms | 2-Chloro-4-(Dimethylaminomethyl)-6-Methyl-Phenol; Brn 2720426; Phenol, 2-Chloro-4-(Dimethylaminomethyl)-6-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H14ClNO |
| Molecular Weight | 199.68 |
| CAS Registry Number | 82965-44-4 |
| SMILES | C1=C(C(=C(C=C1CN(C)C)C)O)Cl |
| InChI | 1S/C10H14ClNO/c1-7-4-8(6-12(2)3)5-9(11)10(7)13/h4-5,13H,6H2,1-3H3 |
| InChIKey | GRRSSGXAKVJEDK-UHFFFAOYSA-N |
| Density | 1.156g/cm3 (Cal.) |
|---|---|
| Boiling point | 259.912°C at 760 mmHg (Cal.) |
| Flash point | 110.991°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-4-(dimethylaminomethyl)-6-methylphenol |