Online Database of Chemicals from Around the World
|
CAS#: 831223-24-6 Product: 3-Ethyl-3-[(4-vinylphenoxy)methyl]oxetane No suppilers available for the product. |
| Name | 3-Ethyl-3-[(4-vinylphenoxy)methyl]oxetane |
|---|---|
| Synonyms | 3-Ethyl-3-[(4-vinylphenoxy)methyl]oxetan; 3-Ethyl-3-[(4-vinylphenoxy)methyl]oxetane; 3-Éthyl-3-[(4-vinylphénoxy)méthyl]oxétane |
| Molecular Structure | ![CAS#: 831223-24-6, 3-Ethyl-3-[(4-vinylphenoxy)methyl]oxetane](/moreStructures/831223-24-6.gif) |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.29 |
| CAS Registry Number | 831223-24-6 |
| SMILES | CCC1(COC1)COc2ccc(cc2)C=C |
| InChI | 1S/C14H18O2/c1-3-12-5-7-13(8-6-12)16-11-14(4-2)9-15-10-14/h3,5-8H,1,4,9-11H2,2H3 |
| InChIKey | NAJFTNKQAAGJQH-UHFFFAOYSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 331.5±15.0°C at 760 mmHg (Cal.) |
| Flash point | 129.8±19.9°C (Cal.) |
| Refractive index | 1.536 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Ethyl-3-[(4-vinylphenoxy)methyl]oxetane |