|
CAS#: 83484-75-7 Product: Pentachlorostyrene No suppilers available for the product. |
| Name | Pentachlorostyrene |
|---|---|
| Synonyms | 1,2,3,4,5-Pentachloro-6-Vinyl-Benzene; 1,2,3,4,5-Pentachloro-6-Vinylbenzene; 1,2,3,4,5-Pentachloro-6-Ethenyl-Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C8H3Cl5 |
| Molecular Weight | 276.38 |
| CAS Registry Number | 83484-75-7 |
| SMILES | C1(=C(C(=C(C(=C1Cl)Cl)C=C)Cl)Cl)Cl |
| InChI | 1S/C8H3Cl5/c1-2-3-4(9)6(11)8(13)7(12)5(3)10/h2H,1H2 |
| InChIKey | AGOFZVAQMFVJEQ-UHFFFAOYSA-N |
| Density | 1.578g/cm3 (Cal.) |
|---|---|
| Boiling point | 344.371°C at 760 mmHg (Cal.) |
| Flash point | 168.682°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Pentachlorostyrene |