|
CAS#: 83488-03-3 Product: 2-Amino-6-Nitro-4-Neopentylphenol No suppilers available for the product. |
| Name | 2-Amino-6-Nitro-4-Neopentylphenol |
|---|---|
| Synonyms | 2-Amino-4-(2,2-Dimethylpropyl)-6-Nitro-Phenol; 2-Amino-4-Neopentyl-6-Nitro-Phenol; 2-Amino-6-Nitro-4-Neopentylphenol |
| Molecular Structure | ![]() |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 |
| CAS Registry Number | 83488-03-3 |
| EINECS | 280-466-1 |
| SMILES | C1=C(C=C(N)C(=C1[N+](=O)[O-])O)CC(C)(C)C |
| InChI | 1S/C11H16N2O3/c1-11(2,3)6-7-4-8(12)10(14)9(5-7)13(15)16/h4-5,14H,6,12H2,1-3H3 |
| InChIKey | NVKBPXZFYMDQOR-UHFFFAOYSA-N |
| Density | 1.216g/cm3 (Cal.) |
|---|---|
| Boiling point | 346.274°C at 760 mmHg (Cal.) |
| Flash point | 163.221°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Amino-6-Nitro-4-Neopentylphenol |