Online Database of Chemicals from Around the World
|
CAS#: 83494-75-1 Product: 9,10-Dihydro-N,N-Diethyl-4-Oxo-4H-Benzo(4,5)Cyclohepta[1,2-b]Furan-3-Carboxamide No suppilers available for the product. |
| Name | 9,10-Dihydro-N,N-Diethyl-4-Oxo-4H-Benzo(4,5)Cyclohepta[1,2-b]Furan-3-Carboxamide |
|---|---|
| Synonyms | 9,10-Dihydro-N,N-Diethyl-4-Oxo-4H-Benzo(4,5)Cyclohepta(1,2-B)Furan-3-Carboxamide |
| Molecular Structure | ![CAS#: 83494-75-1, 9,10-Dihydro-N,N-Diethyl-4-Oxo-4H-Benzo(4,5)Cyclohepta[1,2-b]Furan-3-Carboxamide](/moreStructures/83494-75-1.gif) |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 |
| CAS Registry Number | 83494-75-1 |
| SMILES | C1=C(C3=C(O1)CCC2=CC=CC=C2C3=O)C(=O)N(CC)CC |
| InChI | 1S/C18H19NO3/c1-3-19(4-2)18(21)14-11-22-15-10-9-12-7-5-6-8-13(12)17(20)16(14)15/h5-8,11H,3-4,9-10H2,1-2H3 |
| InChIKey | PPBZMESPFOWJQH-UHFFFAOYSA-N |
| Density | 1.183g/cm3 (Cal.) |
|---|---|
| Boiling point | 503.542°C at 760 mmHg (Cal.) |
| Flash point | 258.333°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9,10-Dihydro-N,N-Diethyl-4-Oxo-4H-Benzo(4,5)Cyclohepta[1,2-b]Furan-3-Carboxamide |