|
CAS#: 83504-21-6 Product: 2,3,6,7-Tetrahydroxycholanoic Acid No suppilers available for the product. |
| Name | 2,3,6,7-Tetrahydroxycholanoic Acid |
|---|---|
| Synonyms | (4R)-4-[(8S,9S,10R,13R,14S,17R)-2,3,6,7-Tetrahydroxy-10,13-Dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-Tetradecahydro-1H-Cyclopenta[A]Phenanthren-17-Yl]Valeric Acid; 2,3,6,7-Tetrahydroxycholanoic Acid; 2,3,6,7-Thca |
| Molecular Structure | ![]() |
| Molecular Formula | C24H40O6 |
| Molecular Weight | 424.58 |
| CAS Registry Number | 83504-21-6 |
| SMILES | [C@@H]23C(C(C1CC(C(C[C@@]1([C@H]2CC[C@]4([C@H]3CC[C@@H]4[C@@H](CCC(=O)O)C)C)C)O)O)O)O |
| InChI | 1S/C24H40O6/c1-12(4-7-19(27)28)13-5-6-14-20-15(8-9-23(13,14)2)24(3)11-18(26)17(25)10-16(24)21(29)22(20)30/h12-18,20-22,25-26,29-30H,4-11H2,1-3H3,(H,27,28)/t12-,13-,14+,15+,16?,17?,18?,20+,21?,22?,23-,24-/m1/s1 |
| InChIKey | KAHZQJKLALFAGB-GJBXGSECSA-N |
| Density | 1.242g/cm3 (Cal.) |
|---|---|
| Boiling point | 584.143°C at 760 mmHg (Cal.) |
| Flash point | 321.117°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3,6,7-Tetrahydroxycholanoic Acid |