|
CAS#: 835-17-6 Product: 9-Dichloromethylene-9H-Fluorene No suppilers available for the product. |
| Name | 9-Dichloromethylene-9H-Fluorene |
|---|---|
| Synonyms | 9-(Dichloromethylene)Fluorene; 9-Dichloromethylenefluorene; 9H-Fluorene, 9-(Dichloromethylene)- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H8Cl2 |
| Molecular Weight | 247.12 |
| CAS Registry Number | 835-17-6 |
| SMILES | C1=CC=CC2=C1C(=C(Cl)Cl)C3=C2C=CC=C3 |
| InChI | 1S/C14H8Cl2/c15-14(16)13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13/h1-8H |
| InChIKey | OAHWJMYLGMZQPX-UHFFFAOYSA-N |
| Density | 1.373g/cm3 (Cal.) |
|---|---|
| Boiling point | 355.224°C at 760 mmHg (Cal.) |
| Flash point | 154.425°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-Dichloromethylene-9H-Fluorene |