|
CAS#: 83682-64-8 Product: 1,3,4-Trichloro-1-(1,1,2-Trichloroethyl)Cyclohexane No suppilers available for the product. |
| Name | 1,3,4-Trichloro-1-(1,1,2-Trichloroethyl)Cyclohexane |
|---|---|
| Synonyms | 1,2,4-Trichloro-4-(1,1,2-Trichloroethyl)Cycloh* |
| Molecular Structure | ![]() |
| Molecular Formula | C8H10Cl6 |
| Molecular Weight | 318.89 |
| CAS Registry Number | 83682-64-8 |
| SMILES | C(C(Cl)(Cl)C1(CCC(Cl)C(C1)Cl)Cl)Cl |
| InChI | 1S/C8H10Cl6/c9-4-8(13,14)7(12)2-1-5(10)6(11)3-7/h5-6H,1-4H2 |
| InChIKey | FYXZFMPUTIIUDH-UHFFFAOYSA-N |
| Density | 1.492g/cm3 (Cal.) |
|---|---|
| Boiling point | 379.866°C at 760 mmHg (Cal.) |
| Flash point | 186.448°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,4-Trichloro-1-(1,1,2-Trichloroethyl)Cyclohexane |