|
CAS#: 83732-71-2 Product: 3-Amino-6-Methoxy-2-Pyridone Hydrochloride No suppilers available for the product. |
| Name | 3-Amino-6-Methoxy-2-Pyridone Hydrochloride |
|---|---|
| Synonyms | 3-Amino-6-Methoxy-2-Pyridone Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C6H9ClN2O2 |
| Molecular Weight | 176.60 |
| CAS Registry Number | 83732-71-2 |
| EINECS | 280-621-3 |
| SMILES | [H+].COC1=CC=C(N)C(=O)N1.[Cl-] |
| InChI | 1S/C6H8N2O2.ClH/c1-10-5-3-2-4(7)6(9)8-5;/h2-3H,7H2,1H3,(H,8,9);1H |
| InChIKey | HGUZCDYIUAOJTA-UHFFFAOYSA-N |
| Boiling point | 385.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 186.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Amino-6-Methoxy-2-Pyridone Hydrochloride |