|
CAS#: 83763-26-2 Product: Ethyl N-formyl-3-oxo-N-(1-phenylethyl)alaninate No suppilers available for the product. |
| Name | Ethyl N-formyl-3-oxo-N-(1-phenylethyl)alaninate |
|---|---|
| Synonyms | ethyl N-formyl-3-oxo-N-(1-phenylethyl)-alaninate |
| Molecular Structure | ![]() |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 |
| CAS Registry Number | 83763-26-2 |
| EINECS | 280-710-7 |
| SMILES | CCOC(=O)C(C=O)N(C=O)C(C)c1ccccc1 |
| InChI | 1S/C14H17NO4/c1-3-19-14(18)13(9-16)15(10-17)11(2)12-7-5-4-6-8-12/h4-11,13H,3H2,1-2H3 |
| InChIKey | KYSCKCJIGHCXMO-UHFFFAOYSA-N |
| Density | 1.156g/cm3 (Cal.) |
|---|---|
| Boiling point | 425.478°C at 760 mmHg (Cal.) |
| Flash point | 211.122°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl N-formyl-3-oxo-N-(1-phenylethyl)alaninate |